C20H32ClN3O6S — CID 169423979
4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide;hydrochloride (PubChem CID 169423979) has the molecular formula C20H32ClN3O6S and a molecular weight of 478.01 g/mol. Its IUPAC name is 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide;hydrochloride.
| Compound Name | 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 169423979 |
| Molecular Formula | C20H32ClN3O6S |
| Molecular Weight | 478.01 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide;hydrochloride |
| SMILES | CCCCOc1ccc(N2CCN(S(=O)(=O)C3(C(=O)NO)CCOCC3)CC2)cc1.Cl |
| InChI | InChI=1S/C20H31N3O6S.ClH/c1-2-3-14-29-18-6-4-17(5-7-18)22-10-12-23(13-11-22)30(26,27)20(19(24)21-25)8-15-28-16-9-20;/h4-7,25H,2-3,8-16H2,1H3,(H,21,24);1H |
| InChIKey | OPDKMBDIFDEIIE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.01 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|