C24H39N5O7S — CID 21068881
4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-4-N-hydroxy-1-N-(2-methoxyethyl)piperidine-1,4-dicarboxamide (PubChem CID 21068881) has the molecular formula C24H39N5O7S and a molecular weight of 541.67 g/mol. Its IUPAC name is 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-4-N-hydroxy-1-N-(2-methoxyethyl)piperidine-1,4-dicarboxamide.
| Compound Name | 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-4-N-hydroxy-1-N-(2-methoxyethyl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 21068881 |
| Molecular Formula | C24H39N5O7S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-4-N-hydroxy-1-N-(2-methoxyethyl)piperidine-1,4-dicarboxamide |
| SMILES | CCCCOc1ccc(N2CCN(S(=O)(=O)C3(C(=O)NO)CCN(C(=O)NCCOC)CC3)CC2)cc1 |
| InChI | InChI=1S/C24H39N5O7S/c1-3-4-18-36-21-7-5-20(6-8-21)27-14-16-29(17-15-27)37(33,34)24(22(30)26-32)9-12-28(13-10-24)23(31)25-11-19-35-2/h5-8,32H,3-4,9-19H2,1-2H3,(H,25,31)(H,26,30) |
| InChIKey | DISLASZRJRQHFN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 140.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|