C23H37N5O5S2 — CID 21068883
4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-1-(dimethylcarbamothioyl)-N-hydroxypiperidine-4-carboxamide (PubChem CID 21068883) has the molecular formula C23H37N5O5S2 and a molecular weight of 527.71 g/mol. Its IUPAC name is 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-1-(dimethylcarbamothioyl)-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-1-(dimethylcarbamothioyl)-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 21068883 |
| Molecular Formula | C23H37N5O5S2 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-1-(dimethylcarbamothioyl)-N-hydroxypiperidine-4-carboxamide |
| SMILES | CCCCOc1ccc(N2CCN(S(=O)(=O)C3(C(=O)NO)CCN(C(=S)N(C)C)CC3)CC2)cc1 |
| InChI | InChI=1S/C23H37N5O5S2/c1-4-5-18-33-20-8-6-19(7-9-20)26-14-16-28(17-15-26)35(31,32)23(21(29)24-30)10-12-27(13-11-23)22(34)25(2)3/h6-9,30H,4-5,10-18H2,1-3H3,(H,24,29) |
| InChIKey | BQTGVTPCHWRYEG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|