C27H47N5O4S — CID 142952315
4-[[4-(4-butoxyphenyl)piperazin-1-yl]-methylidene-oxo-λ6-sulfanyl]-1-[2-(diethylamino)ethyl]-N-hydroxypiperidine-4-carboxamide (PubChem CID 142952315) has the molecular formula C27H47N5O4S and a molecular weight of 537.77 g/mol. Its IUPAC name is 4-[[4-(4-butoxyphenyl)piperazin-1-yl]-methylidene-oxo-λ6-sulfanyl]-1-[2-(diethylamino)ethyl]-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 4-[[4-(4-butoxyphenyl)piperazin-1-yl]-methylidene-oxo-λ6-sulfanyl]-1-[2-(diethylamino)ethyl]-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 142952315 |
| Molecular Formula | C27H47N5O4S |
| Molecular Weight | 537.77 g/mol |
| Exact Mass | 537.33 |
| IUPAC Name | 4-[[4-(4-butoxyphenyl)piperazin-1-yl]-methylidene-oxo-λ6-sulfanyl]-1-[2-(diethylamino)ethyl]-N-hydroxypiperidine-4-carboxamide |
| SMILES | C=S(=O)(N1CCN(c2ccc(OCCCC)cc2)CC1)C1(C(=O)NO)CCN(CCN(CC)CC)CC1 |
| InChI | InChI=1S/C27H47N5O4S/c1-5-8-23-36-25-11-9-24(10-12-25)31-19-21-32(22-20-31)37(4,35)27(26(33)28-34)13-15-30(16-14-27)18-17-29(6-2)7-3/h9-12,34H,4-8,13-23H2,1-3H3,(H,28,33) |
| InChIKey | JAGYLRDAEUUZKU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.77 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|