C23H34ClF3N4O6S — CID 162337910
4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 162337910) has the molecular formula C23H34ClF3N4O6S and a molecular weight of 587.06 g/mol. Its IUPAC name is 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 162337910 |
| Molecular Formula | C23H34ClF3N4O6S |
| Molecular Weight | 587.06 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(3,3,3-trifluoropropanoyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | CCCCOc1ccc(N2CCN(S(=O)(=O)C3(C(=O)NO)CCN(C(=O)CC(F)(F)F)CC3)CC2)cc1.Cl |
| InChI | InChI=1S/C23H33F3N4O6S.ClH/c1-2-3-16-36-19-6-4-18(5-7-19)28-12-14-30(15-13-28)37(34,35)22(21(32)27-33)8-10-29(11-9-22)20(31)17-23(24,25)26;/h4-7,33H,2-3,8-17H2,1H3,(H,27,32);1H |
| InChIKey | SNVZRUIOVDPCTJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.06 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|