C23H33N5O5S2 — CID 21068879
4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(1,3-thiazol-2-yl)piperidine-4-carboxamide (PubChem CID 21068879) has the molecular formula C23H33N5O5S2 and a molecular weight of 523.68 g/mol. Its IUPAC name is 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(1,3-thiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(1,3-thiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 21068879 |
| Molecular Formula | C23H33N5O5S2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 4-[4-(4-butoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(1,3-thiazol-2-yl)piperidine-4-carboxamide |
| SMILES | CCCCOc1ccc(N2CCN(S(=O)(=O)C3(C(=O)NO)CCN(c4nccs4)CC3)CC2)cc1 |
| InChI | InChI=1S/C23H33N5O5S2/c1-2-3-17-33-20-6-4-19(5-7-20)26-13-15-28(16-14-26)35(31,32)23(21(29)25-30)8-11-27(12-9-23)22-24-10-18-34-22/h4-7,10,18,30H,2-3,8-9,11-17H2,1H3,(H,25,29) |
| InChIKey | GZEFYCHCNLDUAQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|