C22H36N2O5S — CID 10160482
1-butyl-N-hydroxy-4-[[4-(3-methylbutoxy)phenyl]methylsulfonyl]piperidine-4-carboxamide (PubChem CID 10160482) has the molecular formula C22H36N2O5S and a molecular weight of 440.61 g/mol. Its IUPAC name is 1-butyl-N-hydroxy-4-[[4-(3-methylbutoxy)phenyl]methylsulfonyl]piperidine-4-carboxamide.
| Compound Name | 1-butyl-N-hydroxy-4-[[4-(3-methylbutoxy)phenyl]methylsulfonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 10160482 |
| Molecular Formula | C22H36N2O5S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 1-butyl-N-hydroxy-4-[[4-(3-methylbutoxy)phenyl]methylsulfonyl]piperidine-4-carboxamide |
| SMILES | CCCCN1CCC(C(=O)NO)(S(=O)(=O)Cc2ccc(OCCC(C)C)cc2)CC1 |
| InChI | InChI=1S/C22H36N2O5S/c1-4-5-13-24-14-11-22(12-15-24,21(25)23-26)30(27,28)17-19-6-8-20(9-7-19)29-16-10-18(2)3/h6-9,18,26H,4-5,10-17H2,1-3H3,(H,23,25) |
| InChIKey | SLWCRCGVKFWWFR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|