C32H45ClN4O7S — CID 169424251
N-hydroxy-1-(2-methoxyethyl)-4-[4-[3-[3-[2-methyl-4-(3-methylbutyl)phenyl]-1,2,4-oxadiazol-5-yl]propoxy]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride (PubChem CID 169424251) has the molecular formula C32H45ClN4O7S and a molecular weight of 665.25 g/mol. Its IUPAC name is N-hydroxy-1-(2-methoxyethyl)-4-[4-[3-[3-[2-methyl-4-(3-methylbutyl)phenyl]-1,2,4-oxadiazol-5-yl]propoxy]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[3-[3-[2-methyl-4-(3-methylbutyl)phenyl]-1,2,4-oxadiazol-5-yl]propoxy]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 169424251 |
| Molecular Formula | C32H45ClN4O7S |
| Molecular Weight | 665.25 g/mol |
| Exact Mass | 664.27 |
| IUPAC Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[3-[3-[2-methyl-4-(3-methylbutyl)phenyl]-1,2,4-oxadiazol-5-yl]propoxy]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride |
| SMILES | COCCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(OCCCc3nc(-c4ccc(CCC(C)C)cc4C)no3)cc2)CC1.Cl |
| InChI | InChI=1S/C32H44N4O7S.ClH/c1-23(2)7-8-25-9-14-28(24(3)22-25)30-33-29(43-35-30)6-5-20-42-26-10-12-27(13-11-26)44(39,40)32(31(37)34-38)15-17-36(18-16-32)19-21-41-4;/h9-14,22-23,38H,5-8,15-21H2,1-4H3,(H,34,37);1H |
| InChIKey | HTNAXCFNRZCFGP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|