C28H35Cl2N3O6S — CID 162334808
N-hydroxy-1-(2-methoxyethyl)-4-[4-[2-(3-pyridin-4-ylphenyl)ethoxy]phenyl]sulfonylpiperidine-4-carboxamide;dihydrochloride (PubChem CID 162334808) has the molecular formula C28H35Cl2N3O6S and a molecular weight of 612.58 g/mol. Its IUPAC name is N-hydroxy-1-(2-methoxyethyl)-4-[4-[2-(3-pyridin-4-ylphenyl)ethoxy]phenyl]sulfonylpiperidine-4-carboxamide;dihydrochloride.
| Compound Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[2-(3-pyridin-4-ylphenyl)ethoxy]phenyl]sulfonylpiperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 162334808 |
| Molecular Formula | C28H35Cl2N3O6S |
| Molecular Weight | 612.58 g/mol |
| Exact Mass | 611.16 |
| IUPAC Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[2-(3-pyridin-4-ylphenyl)ethoxy]phenyl]sulfonylpiperidine-4-carboxamide;dihydrochloride |
| SMILES | COCCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(OCCc3cccc(-c4ccncc4)c3)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C28H33N3O6S.2ClH/c1-36-20-18-31-16-12-28(13-17-31,27(32)30-33)38(34,35)26-7-5-25(6-8-26)37-19-11-22-3-2-4-24(21-22)23-9-14-29-15-10-23;;/h2-10,14-15,21,33H,11-13,16-20H2,1H3,(H,30,32);2*1H |
| InChIKey | RZMYMONBCROLLC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|