C30H35NO5S — CID 67553122
1-(2-methoxyethyl)-4-[4-[3-(3-phenylphenyl)propoxy]phenyl]sulfinylpiperidine-4-carboxylic acid (PubChem CID 67553122) has the molecular formula C30H35NO5S and a molecular weight of 521.68 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4-[4-[3-(3-phenylphenyl)propoxy]phenyl]sulfinylpiperidine-4-carboxylic acid.
| Compound Name | 1-(2-methoxyethyl)-4-[4-[3-(3-phenylphenyl)propoxy]phenyl]sulfinylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 67553122 |
| Molecular Formula | C30H35NO5S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 1-(2-methoxyethyl)-4-[4-[3-(3-phenylphenyl)propoxy]phenyl]sulfinylpiperidine-4-carboxylic acid |
| SMILES | COCCN1CCC(C(=O)O)(S(=O)c2ccc(OCCCc3cccc(-c4ccccc4)c3)cc2)CC1 |
| InChI | InChI=1S/C30H35NO5S/c1-35-22-20-31-18-16-30(17-19-31,29(32)33)37(34)28-14-12-27(13-15-28)36-21-6-8-24-7-5-11-26(23-24)25-9-3-2-4-10-25/h2-5,7,9-15,23H,6,8,16-22H2,1H3,(H,32,33) |
| InChIKey | SLFNJNJMGJBNTL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|