C29H41N3O6S — CID 142895694
1-(2-methoxyethyl)-4-[4-[3-[(3-methyl-4-propan-2-yloxybenzoyl)amino]propoxy]phenyl]sulfinylpiperidine-4-carboxamide (PubChem CID 142895694) has the molecular formula C29H41N3O6S and a molecular weight of 559.73 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4-[4-[3-[(3-methyl-4-propan-2-yloxybenzoyl)amino]propoxy]phenyl]sulfinylpiperidine-4-carboxamide.
| Compound Name | 1-(2-methoxyethyl)-4-[4-[3-[(3-methyl-4-propan-2-yloxybenzoyl)amino]propoxy]phenyl]sulfinylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 142895694 |
| Molecular Formula | C29H41N3O6S |
| Molecular Weight | 559.73 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | 1-(2-methoxyethyl)-4-[4-[3-[(3-methyl-4-propan-2-yloxybenzoyl)amino]propoxy]phenyl]sulfinylpiperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(N)=O)(S(=O)c2ccc(OCCCNC(=O)c3ccc(OC(C)C)c(C)c3)cc2)CC1 |
| InChI | InChI=1S/C29H41N3O6S/c1-21(2)38-26-11-6-23(20-22(26)3)27(33)31-14-5-18-37-24-7-9-25(10-8-24)39(35)29(28(30)34)12-15-32(16-13-29)17-19-36-4/h6-11,20-21H,5,12-19H2,1-4H3,(H2,30,34)(H,31,33) |
| InChIKey | KLKFRYAGRNMMQL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.73 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|