C21H30N2O5S — CID 142186395
4-[4-[3-(cyclopentanecarbonylamino)propoxy]phenyl]sulfinyloxane-4-carboxamide (PubChem CID 142186395) has the molecular formula C21H30N2O5S and a molecular weight of 422.55 g/mol. Its IUPAC name is 4-[4-[3-(cyclopentanecarbonylamino)propoxy]phenyl]sulfinyloxane-4-carboxamide.
| Compound Name | 4-[4-[3-(cyclopentanecarbonylamino)propoxy]phenyl]sulfinyloxane-4-carboxamide |
|---|---|
| PubChem CID | 142186395 |
| Molecular Formula | C21H30N2O5S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 4-[4-[3-(cyclopentanecarbonylamino)propoxy]phenyl]sulfinyloxane-4-carboxamide |
| SMILES | NC(=O)C1(S(=O)c2ccc(OCCCNC(=O)C3CCCC3)cc2)CCOCC1 |
| InChI | InChI=1S/C21H30N2O5S/c22-20(25)21(10-14-27-15-11-21)29(26)18-8-6-17(7-9-18)28-13-3-12-23-19(24)16-4-1-2-5-16/h6-9,16H,1-5,10-15H2,(H2,22,25)(H,23,24) |
| InChIKey | MRVJTAQAXGXNTB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|