C22H27NO5S — CID 142845950
4-[4-[4-(2-ethoxyethoxy)phenyl]phenyl]sulfinyloxane-4-carboxamide (PubChem CID 142845950) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is 4-[4-[4-(2-ethoxyethoxy)phenyl]phenyl]sulfinyloxane-4-carboxamide.
| Compound Name | 4-[4-[4-(2-ethoxyethoxy)phenyl]phenyl]sulfinyloxane-4-carboxamide |
|---|---|
| PubChem CID | 142845950 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 4-[4-[4-(2-ethoxyethoxy)phenyl]phenyl]sulfinyloxane-4-carboxamide |
| SMILES | CCOCCOc1ccc(-c2ccc(S(=O)C3(C(N)=O)CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C22H27NO5S/c1-2-26-15-16-28-19-7-3-17(4-8-19)18-5-9-20(10-6-18)29(25)22(21(23)24)11-13-27-14-12-22/h3-10H,2,11-16H2,1H3,(H2,23,24) |
| InChIKey | SHMFRQHUQLJADG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|