C24H29N3O5S — CID 142186236
4-[4-[2-[2-(2-methylanilino)prop-2-enoylamino]ethoxy]phenyl]sulfinyloxane-4-carboxamide (PubChem CID 142186236) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is 4-[4-[2-[2-(2-methylanilino)prop-2-enoylamino]ethoxy]phenyl]sulfinyloxane-4-carboxamide.
| Compound Name | 4-[4-[2-[2-(2-methylanilino)prop-2-enoylamino]ethoxy]phenyl]sulfinyloxane-4-carboxamide |
|---|---|
| PubChem CID | 142186236 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 4-[4-[2-[2-(2-methylanilino)prop-2-enoylamino]ethoxy]phenyl]sulfinyloxane-4-carboxamide |
| SMILES | C=C(Nc1ccccc1C)C(=O)NCCOc1ccc(S(=O)C2(C(N)=O)CCOCC2)cc1 |
| InChI | InChI=1S/C24H29N3O5S/c1-17-5-3-4-6-21(17)27-18(2)22(28)26-13-16-32-19-7-9-20(10-8-19)33(30)24(23(25)29)11-14-31-15-12-24/h3-10,27H,2,11-16H2,1H3,(H2,25,29)(H,26,28) |
| InChIKey | QVOJLKSUMKYVKR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|