C18H20FNO4 — CID 86836580
3-fluoro-4-methoxy-N-[3-(4-methoxyphenoxy)propyl]benzamide (PubChem CID 86836580) has the molecular formula C18H20FNO4 and a molecular weight of 333.36 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-N-[3-(4-methoxyphenoxy)propyl]benzamide.
| Compound Name | 3-fluoro-4-methoxy-N-[3-(4-methoxyphenoxy)propyl]benzamide |
|---|---|
| PubChem CID | 86836580 |
| Molecular Formula | C18H20FNO4 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 3-fluoro-4-methoxy-N-[3-(4-methoxyphenoxy)propyl]benzamide |
| SMILES | COc1ccc(OCCCNC(=O)c2ccc(OC)c(F)c2)cc1 |
| InChI | InChI=1S/C18H20FNO4/c1-22-14-5-7-15(8-6-14)24-11-3-10-20-18(21)13-4-9-17(23-2)16(19)12-13/h4-9,12H,3,10-11H2,1-2H3,(H,20,21) |
| InChIKey | PFUABRDXYALTFH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|