C21H27NO5 — CID 55416508
3-ethoxy-N-[2-(4-methoxyphenoxy)ethyl]-4-propoxybenzamide (PubChem CID 55416508) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is 3-ethoxy-N-[2-(4-methoxyphenoxy)ethyl]-4-propoxybenzamide.
| Compound Name | 3-ethoxy-N-[2-(4-methoxyphenoxy)ethyl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 55416508 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 3-ethoxy-N-[2-(4-methoxyphenoxy)ethyl]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NCCOc2ccc(OC)cc2)cc1OCC |
| InChI | InChI=1S/C21H27NO5/c1-4-13-27-19-11-6-16(15-20(19)25-5-2)21(23)22-12-14-26-18-9-7-17(24-3)8-10-18/h6-11,15H,4-5,12-14H2,1-3H3,(H,22,23) |
| InChIKey | NVUOSTGNUQRMMP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|