C22H30N2O4 — CID 100535556
3,4-diethoxy-N-[3-(4-methoxy-N-methylanilino)propyl]benzamide (PubChem CID 100535556) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 3,4-diethoxy-N-[3-(4-methoxy-N-methylanilino)propyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[3-(4-methoxy-N-methylanilino)propyl]benzamide |
|---|---|
| PubChem CID | 100535556 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 3,4-diethoxy-N-[3-(4-methoxy-N-methylanilino)propyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCCCN(C)c2ccc(OC)cc2)cc1OCC |
| InChI | InChI=1S/C22H30N2O4/c1-5-27-20-13-8-17(16-21(20)28-6-2)22(25)23-14-7-15-24(3)18-9-11-19(26-4)12-10-18/h8-13,16H,5-7,14-15H2,1-4H3,(H,23,25) |
| InChIKey | UHBYCCVGIGJYMX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|