C35H43ClN2O7S — CID 20620466
4-[4-[3-[3-(4-chlorophenyl)phenyl]propoxy]phenyl]sulfonyl-1-(2-methoxyethyl)-N-(oxan-2-yloxy)piperidine-4-carboxamide (PubChem CID 20620466) has the molecular formula C35H43ClN2O7S and a molecular weight of 671.26 g/mol. Its IUPAC name is 4-[4-[3-[3-(4-chlorophenyl)phenyl]propoxy]phenyl]sulfonyl-1-(2-methoxyethyl)-N-(oxan-2-yloxy)piperidine-4-carboxamide.
| Compound Name | 4-[4-[3-[3-(4-chlorophenyl)phenyl]propoxy]phenyl]sulfonyl-1-(2-methoxyethyl)-N-(oxan-2-yloxy)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20620466 |
| Molecular Formula | C35H43ClN2O7S |
| Molecular Weight | 671.26 g/mol |
| Exact Mass | 670.25 |
| IUPAC Name | 4-[4-[3-[3-(4-chlorophenyl)phenyl]propoxy]phenyl]sulfonyl-1-(2-methoxyethyl)-N-(oxan-2-yloxy)piperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NOC2CCCCO2)(S(=O)(=O)c2ccc(OCCCc3cccc(-c4ccc(Cl)cc4)c3)cc2)CC1 |
| InChI | InChI=1S/C35H43ClN2O7S/c1-42-25-22-38-20-18-35(19-21-38,34(39)37-45-33-9-2-3-23-44-33)46(40,41)32-16-14-31(15-17-32)43-24-5-7-27-6-4-8-29(26-27)28-10-12-30(36)13-11-28/h4,6,8,10-17,26,33H,2-3,5,7,9,18-25H2,1H3,(H,37,39) |
| InChIKey | TXPCGTVLLQRSPP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.26 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|