C25H32N2O5S2 — CID 11584241
1-ethyl-N-(oxan-2-yloxy)-4-(4-phenylsulfanylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 11584241) has the molecular formula C25H32N2O5S2 and a molecular weight of 504.67 g/mol. Its IUPAC name is 1-ethyl-N-(oxan-2-yloxy)-4-(4-phenylsulfanylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-ethyl-N-(oxan-2-yloxy)-4-(4-phenylsulfanylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 11584241 |
| Molecular Formula | C25H32N2O5S2 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 1-ethyl-N-(oxan-2-yloxy)-4-(4-phenylsulfanylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CCN1CCC(C(=O)NOC2CCCCO2)(S(=O)(=O)c2ccc(Sc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C25H32N2O5S2/c1-2-27-17-15-25(16-18-27,24(28)26-32-23-10-6-7-19-31-23)34(29,30)22-13-11-21(12-14-22)33-20-8-4-3-5-9-20/h3-5,8-9,11-14,23H,2,6-7,10,15-19H2,1H3,(H,26,28) |
| InChIKey | MMCWPCBTGDUADA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|