C23H26ClNO7S — CID 11496929
4-[4-(4-chlorophenoxy)phenyl]sulfonyl-N-(oxan-2-yloxy)oxane-4-carboxamide (PubChem CID 11496929) has the molecular formula C23H26ClNO7S and a molecular weight of 495.98 g/mol. Its IUPAC name is 4-[4-(4-chlorophenoxy)phenyl]sulfonyl-N-(oxan-2-yloxy)oxane-4-carboxamide.
| Compound Name | 4-[4-(4-chlorophenoxy)phenyl]sulfonyl-N-(oxan-2-yloxy)oxane-4-carboxamide |
|---|---|
| PubChem CID | 11496929 |
| Molecular Formula | C23H26ClNO7S |
| Molecular Weight | 495.98 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 4-[4-(4-chlorophenoxy)phenyl]sulfonyl-N-(oxan-2-yloxy)oxane-4-carboxamide |
| SMILES | O=C(NOC1CCCCO1)C1(S(=O)(=O)c2ccc(Oc3ccc(Cl)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C23H26ClNO7S/c24-17-4-6-18(7-5-17)31-19-8-10-20(11-9-19)33(27,28)23(12-15-29-16-13-23)22(26)25-32-21-3-1-2-14-30-21/h4-11,21H,1-3,12-16H2,(H,25,26) |
| InChIKey | LNYLKDMPPBJGRV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.98 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|