C25H28F5N3O6S — CID 58623161
N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 58623161) has the molecular formula C25H28F5N3O6S and a molecular weight of 593.57 g/mol. Its IUPAC name is N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 58623161 |
| Molecular Formula | C25H28F5N3O6S |
| Molecular Weight | 593.57 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NOC1CCCCO1)C1(S(=O)(=O)c2ccc(-c3cnc(CCC(F)(F)C(F)(F)F)cn3)cc2)CCOCC1 |
| InChI | InChI=1S/C25H28F5N3O6S/c26-24(27,25(28,29)30)9-8-18-15-32-20(16-31-18)17-4-6-19(7-5-17)40(35,36)23(10-13-37-14-11-23)22(34)33-39-21-3-1-2-12-38-21/h4-7,15-16,21H,1-3,8-14H2,(H,33,34) |
| InChIKey | YDJLIVXXBHWFDL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|