C26H34F3N3O6S — CID 163584854
4-[4-[(Z)-1-(methylideneamino)-2-(6,6,6-trifluorohexan-2-ylideneamino)ethenyl]phenyl]sulfonyl-N-(oxan-2-yloxy)oxane-4-carboxamide (PubChem CID 163584854) has the molecular formula C26H34F3N3O6S and a molecular weight of 573.63 g/mol. Its IUPAC name is 4-[4-[(Z)-1-(methylideneamino)-2-(6,6,6-trifluorohexan-2-ylideneamino)ethenyl]phenyl]sulfonyl-N-(oxan-2-yloxy)oxane-4-carboxamide.
| Compound Name | 4-[4-[(Z)-1-(methylideneamino)-2-(6,6,6-trifluorohexan-2-ylideneamino)ethenyl]phenyl]sulfonyl-N-(oxan-2-yloxy)oxane-4-carboxamide |
|---|---|
| PubChem CID | 163584854 |
| Molecular Formula | C26H34F3N3O6S |
| Molecular Weight | 573.63 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | 4-[4-[(Z)-1-(methylideneamino)-2-(6,6,6-trifluorohexan-2-ylideneamino)ethenyl]phenyl]sulfonyl-N-(oxan-2-yloxy)oxane-4-carboxamide |
| SMILES | C=N/C(=C\N=C(/C)CCCC(F)(F)F)c1ccc(S(=O)(=O)C2(C(=O)NOC3CCCCO3)CCOCC2)cc1 |
| InChI | InChI=1S/C26H34F3N3O6S/c1-19(6-5-12-26(27,28)29)31-18-22(30-2)20-8-10-21(11-9-20)39(34,35)25(13-16-36-17-14-25)24(33)32-38-23-7-3-4-15-37-23/h8-11,18,23H,2-7,12-17H2,1H3,(H,32,33)/b22-18-,31-19+ |
| InChIKey | GKPUEQJVRGNDNL-YOUPUXQVSA-N |
| XLogP | 4.78 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.63 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|