C26H32N2O5S2 — CID 11656495
1-cyclopropyl-N-(oxan-2-yloxy)-4-(4-phenylsulfanylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 11656495) has the molecular formula C26H32N2O5S2 and a molecular weight of 516.69 g/mol. Its IUPAC name is 1-cyclopropyl-N-(oxan-2-yloxy)-4-(4-phenylsulfanylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-cyclopropyl-N-(oxan-2-yloxy)-4-(4-phenylsulfanylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 11656495 |
| Molecular Formula | C26H32N2O5S2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 1-cyclopropyl-N-(oxan-2-yloxy)-4-(4-phenylsulfanylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NOC1CCCCO1)C1(S(=O)(=O)c2ccc(Sc3ccccc3)cc2)CCN(C2CC2)CC1 |
| InChI | InChI=1S/C26H32N2O5S2/c29-25(27-33-24-8-4-5-19-32-24)26(15-17-28(18-16-26)20-9-10-20)35(30,31)23-13-11-22(12-14-23)34-21-6-2-1-3-7-21/h1-3,6-7,11-14,20,24H,4-5,8-10,15-19H2,(H,27,29) |
| InChIKey | ONPIBGCVMMXYFJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|