C18H19NO5S2 — CID 22485342
N-hydroxy-4-(4-phenylsulfanylphenyl)sulfonyloxane-4-carboxamide (PubChem CID 22485342) has the molecular formula C18H19NO5S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-hydroxy-4-(4-phenylsulfanylphenyl)sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-(4-phenylsulfanylphenyl)sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 22485342 |
| Molecular Formula | C18H19NO5S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | N-hydroxy-4-(4-phenylsulfanylphenyl)sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(Sc3ccccc3)cc2)CCOCC1 |
| InChI | InChI=1S/C18H19NO5S2/c20-17(19-21)18(10-12-24-13-11-18)26(22,23)16-8-6-15(7-9-16)25-14-4-2-1-3-5-14/h1-9,21H,10-13H2,(H,19,20) |
| InChIKey | JQHLFVDZHGPVKT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|