C20H20N4O5S2 — CID 22985918
N-hydroxy-4-[4-[4-(1,2,4-triazol-1-yl)phenyl]sulfanylphenyl]sulfonyloxane-4-carboxamide (PubChem CID 22985918) has the molecular formula C20H20N4O5S2 and a molecular weight of 460.54 g/mol. Its IUPAC name is N-hydroxy-4-[4-[4-(1,2,4-triazol-1-yl)phenyl]sulfanylphenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[4-(1,2,4-triazol-1-yl)phenyl]sulfanylphenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 22985918 |
| Molecular Formula | C20H20N4O5S2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | N-hydroxy-4-[4-[4-(1,2,4-triazol-1-yl)phenyl]sulfanylphenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(Sc3ccc(-n4cncn4)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C20H20N4O5S2/c25-19(23-26)20(9-11-29-12-10-20)31(27,28)18-7-5-17(6-8-18)30-16-3-1-15(2-4-16)24-14-21-13-22-24/h1-8,13-14,26H,9-12H2,(H,23,25) |
| InChIKey | DAYMKTUCJJOXJW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|