C26H34N6O6S — CID 46891617
N-hydroxy-4-[4-[4-(4-pyrazin-2-ylpiperazine-1-carbonyl)piperidin-1-yl]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 46891617) has the molecular formula C26H34N6O6S and a molecular weight of 558.66 g/mol. Its IUPAC name is N-hydroxy-4-[4-[4-(4-pyrazin-2-ylpiperazine-1-carbonyl)piperidin-1-yl]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[4-(4-pyrazin-2-ylpiperazine-1-carbonyl)piperidin-1-yl]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 46891617 |
| Molecular Formula | C26H34N6O6S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | N-hydroxy-4-[4-[4-(4-pyrazin-2-ylpiperazine-1-carbonyl)piperidin-1-yl]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(C1CCN(c2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)CC1)N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C26H34N6O6S/c33-24(32-15-13-31(14-16-32)23-19-27-9-10-28-23)20-5-11-30(12-6-20)21-1-3-22(4-2-21)39(36,37)26(25(34)29-35)7-17-38-18-8-26/h1-4,9-10,19-20,35H,5-8,11-18H2,(H,29,34) |
| InChIKey | LZVLSPCMSRJJKT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|