C25H37N3O5S2 — CID 20613870
4-[4-[4-(3,5-dimethylpiperidine-1-carbonyl)piperidin-1-yl]phenyl]sulfonyl-N-hydroxythiane-4-carboxamide (PubChem CID 20613870) has the molecular formula C25H37N3O5S2 and a molecular weight of 523.72 g/mol. Its IUPAC name is 4-[4-[4-(3,5-dimethylpiperidine-1-carbonyl)piperidin-1-yl]phenyl]sulfonyl-N-hydroxythiane-4-carboxamide.
| Compound Name | 4-[4-[4-(3,5-dimethylpiperidine-1-carbonyl)piperidin-1-yl]phenyl]sulfonyl-N-hydroxythiane-4-carboxamide |
|---|---|
| PubChem CID | 20613870 |
| Molecular Formula | C25H37N3O5S2 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | 4-[4-[4-(3,5-dimethylpiperidine-1-carbonyl)piperidin-1-yl]phenyl]sulfonyl-N-hydroxythiane-4-carboxamide |
| SMILES | CC1CC(C)CN(C(=O)C2CCN(c3ccc(S(=O)(=O)C4(C(=O)NO)CCSCC4)cc3)CC2)C1 |
| InChI | InChI=1S/C25H37N3O5S2/c1-18-15-19(2)17-28(16-18)23(29)20-7-11-27(12-8-20)21-3-5-22(6-4-21)35(32,33)25(24(30)26-31)9-13-34-14-10-25/h3-6,18-20,31H,7-17H2,1-2H3,(H,26,30) |
| InChIKey | PCLYONBGSMXMRF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|