C30H41N3O6S — CID 10312074
N-hydroxy-1-(2-methoxyethyl)-4-[4-[4-(4-propylbenzoyl)piperidin-1-yl]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 10312074) has the molecular formula C30H41N3O6S and a molecular weight of 571.74 g/mol. Its IUPAC name is N-hydroxy-1-(2-methoxyethyl)-4-[4-[4-(4-propylbenzoyl)piperidin-1-yl]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[4-(4-propylbenzoyl)piperidin-1-yl]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 10312074 |
| Molecular Formula | C30H41N3O6S |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[4-(4-propylbenzoyl)piperidin-1-yl]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | CCCc1ccc(C(=O)C2CCN(c3ccc(S(=O)(=O)C4(C(=O)NO)CCN(CCOC)CC4)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H41N3O6S/c1-3-4-23-5-7-24(8-6-23)28(34)25-13-17-33(18-14-25)26-9-11-27(12-10-26)40(37,38)30(29(35)31-36)15-19-32(20-16-30)21-22-39-2/h5-12,25,36H,3-4,13-22H2,1-2H3,(H,31,35) |
| InChIKey | VLIMFGLCXWXHPA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|