C16H24N2O5S — CID 142247511
N-hydroxy-1-(2-methoxyethyl)-4-(4-methylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 142247511) has the molecular formula C16H24N2O5S and a molecular weight of 356.44 g/mol. Its IUPAC name is N-hydroxy-1-(2-methoxyethyl)-4-(4-methylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-hydroxy-1-(2-methoxyethyl)-4-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 142247511 |
| Molecular Formula | C16H24N2O5S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-hydroxy-1-(2-methoxyethyl)-4-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C16H24N2O5S/c1-13-3-5-14(6-4-13)24(21,22)16(15(19)17-20)7-9-18(10-8-16)11-12-23-2/h3-6,20H,7-12H2,1-2H3,(H,17,19) |
| InChIKey | GFBUVLUBEJGQQQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|