C16H24N2O5S2 — CID 158009034
N-hydroxy-1-(2-methoxyethyl)-4-(4-methylsulfanylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 158009034) has the molecular formula C16H24N2O5S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-hydroxy-1-(2-methoxyethyl)-4-(4-methylsulfanylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-hydroxy-1-(2-methoxyethyl)-4-(4-methylsulfanylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 158009034 |
| Molecular Formula | C16H24N2O5S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-hydroxy-1-(2-methoxyethyl)-4-(4-methylsulfanylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(SC)cc2)CC1 |
| InChI | InChI=1S/C16H24N2O5S2/c1-23-12-11-18-9-7-16(8-10-18,15(19)17-20)25(21,22)14-5-3-13(24-2)4-6-14/h3-6,20H,7-12H2,1-2H3,(H,17,19) |
| InChIKey | QYZMELGLSDAXLN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|