C20H21F3N2O4S2 — CID 59966497
N-hydroxy-1-methyl-4-[4-[4-(trifluoromethyl)phenyl]sulfanylphenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 59966497) has the molecular formula C20H21F3N2O4S2 and a molecular weight of 474.53 g/mol. Its IUPAC name is N-hydroxy-1-methyl-4-[4-[4-(trifluoromethyl)phenyl]sulfanylphenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-hydroxy-1-methyl-4-[4-[4-(trifluoromethyl)phenyl]sulfanylphenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 59966497 |
| Molecular Formula | C20H21F3N2O4S2 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | N-hydroxy-1-methyl-4-[4-[4-(trifluoromethyl)phenyl]sulfanylphenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(Sc3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C20H21F3N2O4S2/c1-25-12-10-19(11-13-25,18(26)24-27)31(28,29)17-8-6-16(7-9-17)30-15-4-2-14(3-5-15)20(21,22)23/h2-9,27H,10-13H2,1H3,(H,24,26) |
| InChIKey | NDYQLKQSFGNBQX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|