C16H20F3NO3S2 — CID 53328573
N-(2-ethylsulfanylethyl)-1-[4-(trifluoromethyl)phenyl]sulfonylcyclobutane-1-carboxamide (PubChem CID 53328573) has the molecular formula C16H20F3NO3S2 and a molecular weight of 395.47 g/mol. Its IUPAC name is N-(2-ethylsulfanylethyl)-1-[4-(trifluoromethyl)phenyl]sulfonylcyclobutane-1-carboxamide.
| Compound Name | N-(2-ethylsulfanylethyl)-1-[4-(trifluoromethyl)phenyl]sulfonylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 53328573 |
| Molecular Formula | C16H20F3NO3S2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-(2-ethylsulfanylethyl)-1-[4-(trifluoromethyl)phenyl]sulfonylcyclobutane-1-carboxamide |
| SMILES | CCSCCNC(=O)C1(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CCC1 |
| InChI | InChI=1S/C16H20F3NO3S2/c1-2-24-11-10-20-14(21)15(8-3-9-15)25(22,23)13-6-4-12(5-7-13)16(17,18)19/h4-7H,2-3,8-11H2,1H3,(H,20,21) |
| InChIKey | CMYGWIKWEZXEHI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|