C14H19F3N2O3S2 — CID 2801233
N-(2-ethylsulfanylethyl)-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]propanamide (PubChem CID 2801233) has the molecular formula C14H19F3N2O3S2 and a molecular weight of 384.45 g/mol. Its IUPAC name is N-(2-ethylsulfanylethyl)-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]propanamide.
| Compound Name | N-(2-ethylsulfanylethyl)-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]propanamide |
|---|---|
| PubChem CID | 2801233 |
| Molecular Formula | C14H19F3N2O3S2 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-(2-ethylsulfanylethyl)-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]propanamide |
| SMILES | CCSCCNC(=O)C(C)(C)S(=O)(=O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H19F3N2O3S2/c1-4-23-8-7-18-12(20)13(2,3)24(21,22)11-6-5-10(9-19-11)14(15,16)17/h5-6,9H,4,7-8H2,1-3H3,(H,18,20) |
| InChIKey | AZFBZCVRIKDEDG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|