C6H5ClF3NO3S — CID 174615079
5-(trifluoromethyl)pyridine-2-sulfonic acid;hydrochloride (PubChem CID 174615079) has the molecular formula C6H5ClF3NO3S and a molecular weight of 263.62 g/mol. Its IUPAC name is 5-(trifluoromethyl)pyridine-2-sulfonic acid;hydrochloride.
| Compound Name | 5-(trifluoromethyl)pyridine-2-sulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 174615079 |
| Molecular Formula | C6H5ClF3NO3S |
| Molecular Weight | 263.62 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | 5-(trifluoromethyl)pyridine-2-sulfonic acid;hydrochloride |
| SMILES | Cl.O=S(=O)(O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C6H4F3NO3S.ClH/c7-6(8,9)4-1-2-5(10-3-4)14(11,12)13;/h1-3H,(H,11,12,13);1H |
| InChIKey | FQFTVWQQQLSCEZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.62 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|