C8H5F3N2O2S — CID 2820801
2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]acetonitrile (PubChem CID 2820801) has the molecular formula C8H5F3N2O2S and a molecular weight of 250.20 g/mol. Its IUPAC name is 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]acetonitrile.
| Compound Name | 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]acetonitrile |
|---|---|
| PubChem CID | 2820801 |
| Molecular Formula | C8H5F3N2O2S |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]acetonitrile |
| SMILES | N#CCS(=O)(=O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C8H5F3N2O2S/c9-8(10,11)6-1-2-7(13-5-6)16(14,15)4-3-12/h1-2,5H,4H2 |
| InChIKey | QHSGLINBMNSOOR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 70.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |