C9H8F3NO4S — CID 2800689
methyl 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]acetate (PubChem CID 2800689) has the molecular formula C9H8F3NO4S and a molecular weight of 283.23 g/mol. Its IUPAC name is methyl 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]acetate.
| Compound Name | methyl 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]acetate |
|---|---|
| PubChem CID | 2800689 |
| Molecular Formula | C9H8F3NO4S |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | methyl 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]acetate |
| SMILES | COC(=O)CS(=O)(=O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C9H8F3NO4S/c1-17-8(14)5-18(15,16)7-3-2-6(4-13-7)9(10,11)12/h2-4H,5H2,1H3 |
| InChIKey | PCBZIMCRNCIBHJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |