C15H10Br2F3N3O3S — CID 45109409
N-[(E)-(3,4-dibromophenyl)methylideneamino]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]acetamide (PubChem CID 45109409) has the molecular formula C15H10Br2F3N3O3S and a molecular weight of 529.13 g/mol. Its IUPAC name is N-[(E)-(3,4-dibromophenyl)methylideneamino]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]acetamide.
| Compound Name | N-[(E)-(3,4-dibromophenyl)methylideneamino]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]acetamide |
|---|---|
| PubChem CID | 45109409 |
| Molecular Formula | C15H10Br2F3N3O3S |
| Molecular Weight | 529.13 g/mol |
| Exact Mass | 526.88 |
| IUPAC Name | N-[(E)-(3,4-dibromophenyl)methylideneamino]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]acetamide |
| SMILES | O=C(CS(=O)(=O)c1ccc(C(F)(F)F)cn1)N/N=C/c1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C15H10Br2F3N3O3S/c16-11-3-1-9(5-12(11)17)6-22-23-13(24)8-27(25,26)14-4-2-10(7-21-14)15(18,19)20/h1-7H,8H2,(H,23,24)/b22-6+ |
| InChIKey | FZPLJSKMEZMJHG-GEVRCRHISA-N |
| XLogP | 3.55 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.13 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|