C15H11BrF3N3O2 — CID 2318414
N-[(3-bromophenyl)methylideneamino]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 2318414) has the molecular formula C15H11BrF3N3O2 and a molecular weight of 402.17 g/mol. Its IUPAC name is N-[(3-bromophenyl)methylideneamino]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-[(3-bromophenyl)methylideneamino]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 2318414 |
| Molecular Formula | C15H11BrF3N3O2 |
| Molecular Weight | 402.17 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | N-[(3-bromophenyl)methylideneamino]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | O=C(Cn1cc(C(F)(F)F)ccc1=O)NN=Cc1cccc(Br)c1 |
| InChI | InChI=1S/C15H11BrF3N3O2/c16-12-3-1-2-10(6-12)7-20-21-13(23)9-22-8-11(15(17,18)19)4-5-14(22)24/h1-8H,9H2,(H,21,23) |
| InChIKey | KAJYXMWUACNLQR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.17 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|