C16H12F5N3O3 — CID 6899831
N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 6899831) has the molecular formula C16H12F5N3O3 and a molecular weight of 389.28 g/mol. Its IUPAC name is N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 6899831 |
| Molecular Formula | C16H12F5N3O3 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | O=C(Cn1cc(C(F)(F)F)ccc1=O)N/N=C/c1ccccc1OC(F)F |
| InChI | InChI=1S/C16H12F5N3O3/c17-15(18)27-12-4-2-1-3-10(12)7-22-23-13(25)9-24-8-11(16(19,20)21)5-6-14(24)26/h1-8,15H,9H2,(H,23,25)/b22-7+ |
| InChIKey | YZTUSVWTAZVUSO-QPJQQBGISA-N |
| XLogP | 2.62 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|