C16H12BrF3N2O4 — CID 18280639
[2-(3-bromoanilino)-2-oxoethyl] 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate (PubChem CID 18280639) has the molecular formula C16H12BrF3N2O4 and a molecular weight of 433.18 g/mol. Its IUPAC name is [2-(3-bromoanilino)-2-oxoethyl] 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate.
| Compound Name | [2-(3-bromoanilino)-2-oxoethyl] 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate |
|---|---|
| PubChem CID | 18280639 |
| Molecular Formula | C16H12BrF3N2O4 |
| Molecular Weight | 433.18 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | [2-(3-bromoanilino)-2-oxoethyl] 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate |
| SMILES | O=C(COC(=O)Cn1cc(C(F)(F)F)ccc1=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C16H12BrF3N2O4/c17-11-2-1-3-12(6-11)21-13(23)9-26-15(25)8-22-7-10(16(18,19)20)4-5-14(22)24/h1-7H,8-9H2,(H,21,23) |
| InChIKey | BHTUWWSQCIEGOT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |