C20H20F3NO4 — CID 55315611
[2-(4-tert-butylphenyl)-2-oxoethyl] 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate (PubChem CID 55315611) has the molecular formula C20H20F3NO4 and a molecular weight of 395.38 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)-2-oxoethyl] 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate.
| Compound Name | [2-(4-tert-butylphenyl)-2-oxoethyl] 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate |
|---|---|
| PubChem CID | 55315611 |
| Molecular Formula | C20H20F3NO4 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | [2-(4-tert-butylphenyl)-2-oxoethyl] 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate |
| SMILES | CC(C)(C)c1ccc(C(=O)COC(=O)Cn2cc(C(F)(F)F)ccc2=O)cc1 |
| InChI | InChI=1S/C20H20F3NO4/c1-19(2,3)14-6-4-13(5-7-14)16(25)12-28-18(27)11-24-10-15(20(21,22)23)8-9-17(24)26/h4-10H,11-12H2,1-3H3 |
| InChIKey | UQMKNZHVHBZWGY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |