C18H17F3N2O5 — CID 18268883
[2-(2-ethoxyanilino)-2-oxoethyl] 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate (PubChem CID 18268883) has the molecular formula C18H17F3N2O5 and a molecular weight of 398.34 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate |
|---|---|
| PubChem CID | 18268883 |
| Molecular Formula | C18H17F3N2O5 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)Cn1cc(C(F)(F)F)ccc1=O |
| InChI | InChI=1S/C18H17F3N2O5/c1-2-27-14-6-4-3-5-13(14)22-15(24)11-28-17(26)10-23-9-12(18(19,20)21)7-8-16(23)25/h3-9H,2,10-11H2,1H3,(H,22,24) |
| InChIKey | WRINTOXBOQWOSZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |