C20H19N3O4S — CID 31867338
[2-(2-ethoxyanilino)-2-oxoethyl] 2-quinoxalin-2-ylsulfanylacetate (PubChem CID 31867338) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 2-quinoxalin-2-ylsulfanylacetate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-quinoxalin-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 31867338 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-quinoxalin-2-ylsulfanylacetate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)CSc1cnc2ccccc2n1 |
| InChI | InChI=1S/C20H19N3O4S/c1-2-26-17-10-6-5-9-16(17)22-18(24)12-27-20(25)13-28-19-11-21-14-7-3-4-8-15(14)23-19/h3-11H,2,12-13H2,1H3,(H,22,24) |
| InChIKey | CVDGCTCGBDGVOP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |