C18H17N3O3S2 — CID 33329578
[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-quinoxalin-2-ylsulfanylacetate (PubChem CID 33329578) has the molecular formula C18H17N3O3S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-quinoxalin-2-ylsulfanylacetate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-quinoxalin-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 33329578 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-quinoxalin-2-ylsulfanylacetate |
| SMILES | O=C(COC(=O)CSc1cnc2ccccc2n1)NCCc1cccs1 |
| InChI | InChI=1S/C18H17N3O3S2/c22-16(19-8-7-13-4-3-9-25-13)11-24-18(23)12-26-17-10-20-14-5-1-2-6-15(14)21-17/h1-6,9-10H,7-8,11-12H2,(H,19,22) |
| InChIKey | BKZVAACGCUOXJC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |