C14H14N4O4S — CID 32508024
[2-(methylcarbamoylamino)-2-oxoethyl] 2-quinoxalin-2-ylsulfanylacetate (PubChem CID 32508024) has the molecular formula C14H14N4O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 2-quinoxalin-2-ylsulfanylacetate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-quinoxalin-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 32508024 |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-quinoxalin-2-ylsulfanylacetate |
| SMILES | CNC(=O)NC(=O)COC(=O)CSc1cnc2ccccc2n1 |
| InChI | InChI=1S/C14H14N4O4S/c1-15-14(21)18-11(19)7-22-13(20)8-23-12-6-16-9-4-2-3-5-10(9)17-12/h2-6H,7-8H2,1H3,(H2,15,18,19,21) |
| InChIKey | SXQKPFKWZFLPSI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |