C11H11F3N2O4 — CID 42901397
(1-amino-1-oxopropan-2-yl) 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate (PubChem CID 42901397) has the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. Its IUPAC name is (1-amino-1-oxopropan-2-yl) 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate.
| Compound Name | (1-amino-1-oxopropan-2-yl) 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate |
|---|---|
| PubChem CID | 42901397 |
| Molecular Formula | C11H11F3N2O4 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (1-amino-1-oxopropan-2-yl) 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate |
| SMILES | CC(OC(=O)Cn1cc(C(F)(F)F)ccc1=O)C(N)=O |
| InChI | InChI=1S/C11H11F3N2O4/c1-6(10(15)19)20-9(18)5-16-4-7(11(12,13)14)2-3-8(16)17/h2-4,6H,5H2,1H3,(H2,15,19) |
| InChIKey | WDZVXEVDPFMJPU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |