C18H18F3NO4 — CID 8903016
2-(3-ethylphenoxy)ethyl 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate (PubChem CID 8903016) has the molecular formula C18H18F3NO4 and a molecular weight of 369.34 g/mol. Its IUPAC name is 2-(3-ethylphenoxy)ethyl 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate.
| Compound Name | 2-(3-ethylphenoxy)ethyl 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate |
|---|---|
| PubChem CID | 8903016 |
| Molecular Formula | C18H18F3NO4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-(3-ethylphenoxy)ethyl 2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetate |
| SMILES | CCc1cccc(OCCOC(=O)Cn2cc(C(F)(F)F)ccc2=O)c1 |
| InChI | InChI=1S/C18H18F3NO4/c1-2-13-4-3-5-15(10-13)25-8-9-26-17(24)12-22-11-14(18(19,20)21)6-7-16(22)23/h3-7,10-11H,2,8-9,12H2,1H3 |
| InChIKey | JPHGFGSNNMWTHG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|