C10H13N3O4 — CID 62814992
(1-amino-1-oxopropan-2-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate (PubChem CID 62814992) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is (1-amino-1-oxopropan-2-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate.
| Compound Name | (1-amino-1-oxopropan-2-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate |
|---|---|
| PubChem CID | 62814992 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | (1-amino-1-oxopropan-2-yl) 2-(5-amino-2-oxo-1-pyridinyl)acetate |
| SMILES | CC(OC(=O)Cn1cc(N)ccc1=O)C(N)=O |
| InChI | InChI=1S/C10H13N3O4/c1-6(10(12)16)17-9(15)5-13-4-7(11)2-3-8(13)14/h2-4,6H,5,11H2,1H3,(H2,12,16) |
| InChIKey | RNGZEWCHJPOYRT-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |