C12H18N2O3 — CID 62814988
pentyl 2-(5-amino-2-oxo-1-pyridinyl)acetate (PubChem CID 62814988) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is pentyl 2-(5-amino-2-oxo-1-pyridinyl)acetate.
| Compound Name | pentyl 2-(5-amino-2-oxo-1-pyridinyl)acetate |
|---|---|
| PubChem CID | 62814988 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | pentyl 2-(5-amino-2-oxo-1-pyridinyl)acetate |
| SMILES | CCCCCOC(=O)Cn1cc(N)ccc1=O |
| InChI | InChI=1S/C12H18N2O3/c1-2-3-4-7-17-12(16)9-14-8-10(13)5-6-11(14)15/h5-6,8H,2-4,7,9,13H2,1H3 |
| InChIKey | BMIXOUKTJINGQL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|