C15H20N2O3 — CID 79561821
2-bicyclo[2.2.1]heptanylmethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate (PubChem CID 79561821) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanylmethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate.
| Compound Name | 2-bicyclo[2.2.1]heptanylmethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate |
|---|---|
| PubChem CID | 79561821 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanylmethyl 2-(5-amino-2-oxo-1-pyridinyl)acetate |
| SMILES | Nc1ccc(=O)n(CC(=O)OCC2CC3CCC2C3)c1 |
| InChI | InChI=1S/C15H20N2O3/c16-13-3-4-14(18)17(7-13)8-15(19)20-9-12-6-10-1-2-11(12)5-10/h3-4,7,10-12H,1-2,5-6,8-9,16H2 |
| InChIKey | OAODZMREFWJPTG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |